What is the most accurate name for the covalent compound n2o?

What is the most accurate name for the covalent compound n2o?

N2O is called dinitrogen monoxide. (It is also called nitrous oxide but that is another naming scheme.)

What is the name for the compound with the formula SO3?

SULFITE ION

What is the name for the compound with the formula P4S3?

IUPAC Name
Alternative Names Tetraphosphorus trisulfide PHOSPHORUS SESQUISULFIDE Trisulfurated phosphorus Phosphorous sesquisulfide Tetraphosphorus trisulphide
Molecular Formula P4S3
Molar Mass 220.075 g/mol
InChI InChI=1S/P4S3/c5-1-2-3(1)7-4(5)6-2

Which rule is used for writing the name of an ionic base?

Terms in this set (23) Which rule is used for writing the name of an ionic base? The chemical name ends with “hydroxide.”

What do you call SO3?

SO3 is also called sulfuric oxide and sulfuric anhydride. It is used in the production of sulfuric acid and other chemicals, and explosives. Sulfuric acid is a clear, colorless, oily liquid that is very corrosive. It is also called sulphine acid, battery acid, and hy drogen sulfate.

Is SO3 2 an acid or base?

Sulfite is a sulfur oxoanion that is the conjugate base of hydrogen sulfite (H2SO3). It is a sulfur oxoanion, a sulfur oxide and a divalent inorganic anion. It is a conjugate base of a hydrogensulfite….3.1Computed Properties.

Property Name Property Value Reference
Formal Charge -2 Computed by PubChem

Why is SO3 called sulfite?

Sulfur Trioxide is a neutral molecule because it has the same amount of electrons as protons. So yes they both have the same atoms SO3 but they have different chemical properties because having more electrons is probably going to make sulfite (SO3 2-) more reactive with other molecules and elements.

What does the 3 mean in SO3?

Sulfur trioxide

What is the mole of SO3?

We assume you are converting between moles SO3 and gram. You can view more details on each measurement unit: molecular weight of SO3 or grams This compound is also known as Sulfur Trioxide. The SI base unit for amount of substance is the mole. 1 mole is equal to 1 moles SO3, or 80.0632 grams.

Begin typing your search term above and press enter to search. Press ESC to cancel.

Back To Top